C15H30O2S2Si — CID 10382265
O-[(E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enyl] methylsulfanylmethanethioate (PubChem CID 10382265) has the molecular formula C15H30O2S2Si and a molecular weight of 334.62 g/mol. Its IUPAC name is O-[(E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enyl] methylsulfanylmethanethioate.
| Compound Name | O-[(E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enyl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 10382265 |
| Molecular Formula | C15H30O2S2Si |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | O-[(E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-2-enyl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)OC/C(C)=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O2S2Si/c1-12(10-16-14(18)19-6)9-13(2)11-17-20(7,8)15(3,4)5/h9,13H,10-11H2,1-8H3/b12-9+/t13-/m1/s1 |
| InChIKey | KGJDRUARXJNDEM-CNELAYHGSA-N |
| XLogP | 5.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|