C21H42O3SSi — CID 10525186
methyl (E,2S,3S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-3-tert-butylsulfanyl-2,4,6-trimethylhept-4-enoate (PubChem CID 10525186) has the molecular formula C21H42O3SSi and a molecular weight of 402.72 g/mol. Its IUPAC name is methyl (E,2S,3S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-3-tert-butylsulfanyl-2,4,6-trimethylhept-4-enoate.
| Compound Name | methyl (E,2S,3S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-3-tert-butylsulfanyl-2,4,6-trimethylhept-4-enoate |
|---|---|
| PubChem CID | 10525186 |
| Molecular Formula | C21H42O3SSi |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | methyl (E,2S,3S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-3-tert-butylsulfanyl-2,4,6-trimethylhept-4-enoate |
| SMILES | COC(=O)[C@H](C)[C@H](SC(C)(C)C)/C(C)=C/[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3SSi/c1-15(14-24-26(11,12)21(7,8)9)13-16(2)18(25-20(4,5)6)17(3)19(22)23-10/h13,15,17-18H,14H2,1-12H3/b16-13+/t15-,17+,18+/m0/s1 |
| InChIKey | VYKKLZXLYFIWNO-ABCPAJAMSA-N |
| XLogP | 6.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|