C22H42O5Si — CID 134970323
methyl (5S,6R,7R)-5-hydroxy-6-methyl-3-oxo-7-tri(propan-2-yl)silyloxyundec-10-enoate (PubChem CID 134970323) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is methyl (5S,6R,7R)-5-hydroxy-6-methyl-3-oxo-7-tri(propan-2-yl)silyloxyundec-10-enoate.
| Compound Name | methyl (5S,6R,7R)-5-hydroxy-6-methyl-3-oxo-7-tri(propan-2-yl)silyloxyundec-10-enoate |
|---|---|
| PubChem CID | 134970323 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | methyl (5S,6R,7R)-5-hydroxy-6-methyl-3-oxo-7-tri(propan-2-yl)silyloxyundec-10-enoate |
| SMILES | C=CCC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)[C@@H](O)CC(=O)CC(=O)OC |
| InChI | InChI=1S/C22H42O5Si/c1-10-11-12-21(27-28(15(2)3,16(4)5)17(6)7)18(8)20(24)13-19(23)14-22(25)26-9/h10,15-18,20-21,24H,1,11-14H2,2-9H3/t18-,20+,21-/m1/s1 |
| InChIKey | ICNXFTNGGKHDEV-HLAWJBBLSA-N |
| XLogP | 5.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|