C25H50O5Si2 — CID 25107811
ethyl 2-[(2S,3R,5R)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]but-3-enyl]-3-methyloxolan-2-yl]acetate (PubChem CID 25107811) has the molecular formula C25H50O5Si2 and a molecular weight of 486.84 g/mol. Its IUPAC name is ethyl 2-[(2S,3R,5R)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]but-3-enyl]-3-methyloxolan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3R,5R)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]but-3-enyl]-3-methyloxolan-2-yl]acetate |
|---|---|
| PubChem CID | 25107811 |
| Molecular Formula | C25H50O5Si2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | ethyl 2-[(2S,3R,5R)-5-[(1S,2R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]but-3-enyl]-3-methyloxolan-2-yl]acetate |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C[C@@H](C)[C@H](CC(=O)OCC)O1 |
| InChI | InChI=1S/C25H50O5Si2/c1-14-19(29-31(10,11)24(4,5)6)23(30-32(12,13)25(7,8)9)21-16-18(3)20(28-21)17-22(26)27-15-2/h14,18-21,23H,1,15-17H2,2-13H3/t18-,19-,20+,21-,23-/m1/s1 |
| InChIKey | DQXHIQVTPPYFBV-ZFVIQDPVSA-N |
| XLogP | 6.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|