C20H38O5Si — CID 25001342
methyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-ethenyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentanoate (PubChem CID 25001342) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is methyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-ethenyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentanoate.
| Compound Name | methyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-ethenyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentanoate |
|---|---|
| PubChem CID | 25001342 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | methyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-ethenyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentanoate |
| SMILES | C=C[C@H]1OC(C)(C)O[C@@]1(C)CC[C@@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O5Si/c1-11-16-20(7,25-19(5,6)23-16)13-12-15(14-17(21)22-8)24-26(9,10)18(2,3)4/h11,15-16H,1,12-14H2,2-10H3/t15-,16+,20-/m0/s1 |
| InChIKey | ZEBJXHCNCXNSSB-YRNRMSPPSA-N |
| XLogP | 4.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|