C22H42O6Si — CID 25001639
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-[(E,3R)-4-hydroxy-3-methylbut-1-enyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentanoic acid (PubChem CID 25001639) has the molecular formula C22H42O6Si and a molecular weight of 430.66 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-[(E,3R)-4-hydroxy-3-methylbut-1-enyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentanoic acid.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-[(E,3R)-4-hydroxy-3-methylbut-1-enyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 25001639 |
| Molecular Formula | C22H42O6Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-[(E,3R)-4-hydroxy-3-methylbut-1-enyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentanoic acid |
| SMILES | C[C@H](/C=C/[C@H]1OC(C)(C)O[C@@]1(C)CC[C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)CO |
| InChI | InChI=1S/C22H42O6Si/c1-16(15-23)10-11-18-22(7,28-21(5,6)26-18)13-12-17(14-19(24)25)27-29(8,9)20(2,3)4/h10-11,16-18,23H,12-15H2,1-9H3,(H,24,25)/b11-10+/t16-,17+,18-,22+/m1/s1 |
| InChIKey | CMQSUCKPZHOUOC-QEIJUAOCSA-N |
| XLogP | 4.73 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|