C19H32O7Si — CID 134930678
methyl (3E,3aR,6S,7R,7aR)-3a-hydroxy-3-(2-hydroxyethylidene)-6-methyl-7-(2-trimethylsilylethoxymethoxy)-7,7a-dihydro-6H-1-benzofuran-4-carboxylate (PubChem CID 134930678) has the molecular formula C19H32O7Si and a molecular weight of 400.54 g/mol. Its IUPAC name is methyl (3E,3aR,6S,7R,7aR)-3a-hydroxy-3-(2-hydroxyethylidene)-6-methyl-7-(2-trimethylsilylethoxymethoxy)-7,7a-dihydro-6H-1-benzofuran-4-carboxylate.
| Compound Name | methyl (3E,3aR,6S,7R,7aR)-3a-hydroxy-3-(2-hydroxyethylidene)-6-methyl-7-(2-trimethylsilylethoxymethoxy)-7,7a-dihydro-6H-1-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 134930678 |
| Molecular Formula | C19H32O7Si |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | methyl (3E,3aR,6S,7R,7aR)-3a-hydroxy-3-(2-hydroxyethylidene)-6-methyl-7-(2-trimethylsilylethoxymethoxy)-7,7a-dihydro-6H-1-benzofuran-4-carboxylate |
| SMILES | COC(=O)C1=C[C@H](C)[C@@H](OCOCC[Si](C)(C)C)[C@H]2OC/C(=C\CO)[C@@]12O |
| InChI | InChI=1S/C19H32O7Si/c1-13-10-15(18(21)23-2)19(22)14(6-7-20)11-25-17(19)16(13)26-12-24-8-9-27(3,4)5/h6,10,13,16-17,20,22H,7-9,11-12H2,1-5H3/b14-6+/t13-,16+,17+,19+/m0/s1 |
| InChIKey | CPRLUYVRIFNMFQ-YUYSUCEHSA-N |
| XLogP | 1.48 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|