C17H30O4Si — CID 134973767
(3R,4R,5S)-4-hydroxy-5-[(4Z,6E)-3-hydroxy-4-trimethylsilylocta-4,6-dienyl]-3,5-dimethyloxolan-2-one (PubChem CID 134973767) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is (3R,4R,5S)-4-hydroxy-5-[(4Z,6E)-3-hydroxy-4-trimethylsilylocta-4,6-dienyl]-3,5-dimethyloxolan-2-one.
| Compound Name | (3R,4R,5S)-4-hydroxy-5-[(4Z,6E)-3-hydroxy-4-trimethylsilylocta-4,6-dienyl]-3,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 134973767 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (3R,4R,5S)-4-hydroxy-5-[(4Z,6E)-3-hydroxy-4-trimethylsilylocta-4,6-dienyl]-3,5-dimethyloxolan-2-one |
| SMILES | C/C=C/C=C(/C(O)CC[C@]1(C)OC(=O)[C@H](C)[C@H]1O)[Si](C)(C)C |
| InChI | InChI=1S/C17H30O4Si/c1-7-8-9-14(22(4,5)6)13(18)10-11-17(3)15(19)12(2)16(20)21-17/h7-9,12-13,15,18-19H,10-11H2,1-6H3/b8-7+,14-9-/t12-,13?,15-,17+/m1/s1 |
| InChIKey | LVTLCWDPYMDHBO-ANNFUVBFSA-N |
| XLogP | 2.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|