C25H46O7Si — CID 135027787
(1R,3S,4R,7R,8S,9E,14R)-3-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-8,11-dihydroxy-14-methoxy-4,8,14-trimethyl-6,15-dioxabicyclo[9.3.1]pentadec-9-en-5-one (PubChem CID 135027787) has the molecular formula C25H46O7Si and a molecular weight of 486.72 g/mol. Its IUPAC name is (1R,3S,4R,7R,8S,9E,14R)-3-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-8,11-dihydroxy-14-methoxy-4,8,14-trimethyl-6,15-dioxabicyclo[9.3.1]pentadec-9-en-5-one.
| Compound Name | (1R,3S,4R,7R,8S,9E,14R)-3-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-8,11-dihydroxy-14-methoxy-4,8,14-trimethyl-6,15-dioxabicyclo[9.3.1]pentadec-9-en-5-one |
|---|---|
| PubChem CID | 135027787 |
| Molecular Formula | C25H46O7Si |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (1R,3S,4R,7R,8S,9E,14R)-3-[tert-butyl(dimethyl)silyl]oxy-7-ethyl-8,11-dihydroxy-14-methoxy-4,8,14-trimethyl-6,15-dioxabicyclo[9.3.1]pentadec-9-en-5-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]2OC(O)(/C=C/[C@]1(C)O)CC[C@@]2(C)OC |
| InChI | InChI=1S/C25H46O7Si/c1-11-19-23(6,27)12-14-25(28)15-13-24(7,29-8)20(31-25)16-18(17(2)21(26)30-19)32-33(9,10)22(3,4)5/h12,14,17-20,27-28H,11,13,15-16H2,1-10H3/b14-12+/t17-,18+,19-,20-,23+,24-,25?/m1/s1 |
| InChIKey | QXFKYDRIFGHBCT-KKKYWEBOSA-N |
| XLogP | 4.32 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|