C31H60O7Si2 — CID 54577930
(3R,4S,6R,7R,11E,13S,14R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-13-hydroxy-6-methoxy-3,7,13-trimethyl-1-oxacyclotetradec-11-ene-2,10-dione (PubChem CID 54577930) has the molecular formula C31H60O7Si2 and a molecular weight of 600.99 g/mol. Its IUPAC name is (3R,4S,6R,7R,11E,13S,14R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-13-hydroxy-6-methoxy-3,7,13-trimethyl-1-oxacyclotetradec-11-ene-2,10-dione.
| Compound Name | (3R,4S,6R,7R,11E,13S,14R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-13-hydroxy-6-methoxy-3,7,13-trimethyl-1-oxacyclotetradec-11-ene-2,10-dione |
|---|---|
| PubChem CID | 54577930 |
| Molecular Formula | C31H60O7Si2 |
| Molecular Weight | 600.99 g/mol |
| Exact Mass | 600.39 |
| IUPAC Name | (3R,4S,6R,7R,11E,13S,14R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-14-ethyl-13-hydroxy-6-methoxy-3,7,13-trimethyl-1-oxacyclotetradec-11-ene-2,10-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](OC)[C@](C)(O[Si](C)(C)C(C)(C)C)CCC(=O)/C=C/[C@]1(C)O |
| InChI | InChI=1S/C31H60O7Si2/c1-16-25-30(9,34)19-17-23(32)18-20-31(10,38-40(14,15)29(6,7)8)26(35-11)21-24(22(2)27(33)36-25)37-39(12,13)28(3,4)5/h17,19,22,24-26,34H,16,18,20-21H2,1-15H3/b19-17+/t22-,24+,25-,26-,30+,31-/m1/s1 |
| InChIKey | CRSMOORZIVOUCP-BUQPIDLOSA-N |
| XLogP | 7.19 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.99 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|