C37H77IO7Si3 — CID 54577711
[(E,3R,4S)-4-hydroxy-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3,6,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethylnonanoate (PubChem CID 54577711) has the molecular formula C37H77IO7Si3 and a molecular weight of 845.18 g/mol. Its IUPAC name is [(E,3R,4S)-4-hydroxy-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3,6,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethylnonanoate.
| Compound Name | [(E,3R,4S)-4-hydroxy-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3,6,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethylnonanoate |
|---|---|
| PubChem CID | 54577711 |
| Molecular Formula | C37H77IO7Si3 |
| Molecular Weight | 845.18 g/mol |
| Exact Mass | 844.40 |
| IUPAC Name | [(E,3R,4S)-4-hydroxy-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3,6,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethylnonanoate |
| SMILES | CC[C@@H](OC(=O)[C@H](C)[C@H](C[C@@H](OC)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@](C)(O)/C=C/I |
| InChI | InChI=1S/C37H77IO7Si3/c1-21-30(36(12,40)24-25-38)43-32(39)28(2)29(44-47(17,18)34(6,7)8)27-31(41-14)37(13,45-48(19,20)35(9,10)11)23-22-26-42-46(15,16)33(3,4)5/h24-25,28-31,40H,21-23,26-27H2,1-20H3/b25-24+/t28-,29+,30-,31-,36+,37-/m1/s1 |
| InChIKey | HOUYFTJOUNEEOI-HPFOMNJGSA-N |
| XLogP | 11.02 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.18 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|