C32H62O7Si2 — CID 135043679
(3R,4S,6R,7R,9R,11E,13S,14R)-4-[tert-butyl(dimethyl)silyl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,7,9,13-tetramethyl-6-triethylsilyloxy-1-oxacyclotetradec-11-ene-2,10-dione (PubChem CID 135043679) has the molecular formula C32H62O7Si2 and a molecular weight of 615.01 g/mol. Its IUPAC name is (3R,4S,6R,7R,9R,11E,13S,14R)-4-[tert-butyl(dimethyl)silyl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,7,9,13-tetramethyl-6-triethylsilyloxy-1-oxacyclotetradec-11-ene-2,10-dione.
| Compound Name | (3R,4S,6R,7R,9R,11E,13S,14R)-4-[tert-butyl(dimethyl)silyl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,7,9,13-tetramethyl-6-triethylsilyloxy-1-oxacyclotetradec-11-ene-2,10-dione |
|---|---|
| PubChem CID | 135043679 |
| Molecular Formula | C32H62O7Si2 |
| Molecular Weight | 615.01 g/mol |
| Exact Mass | 614.40 |
| IUPAC Name | (3R,4S,6R,7R,9R,11E,13S,14R)-4-[tert-butyl(dimethyl)silyl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,7,9,13-tetramethyl-6-triethylsilyloxy-1-oxacyclotetradec-11-ene-2,10-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](O[Si](CC)(CC)CC)[C@](C)(OC)C[C@@H](C)C(=O)/C=C/[C@]1(C)O |
| InChI | InChI=1S/C32H62O7Si2/c1-15-27-31(10,35)20-19-25(33)23(5)22-32(11,36-12)28(39-41(16-2,17-3)18-4)21-26(24(6)29(34)37-27)38-40(13,14)30(7,8)9/h19-20,23-24,26-28,35H,15-18,21-22H2,1-14H3/b20-19+/t23-,24-,26+,27-,28-,31+,32-/m1/s1 |
| InChIKey | ZSQOZAFCUNLHRB-OTUDGLMJSA-N |
| XLogP | 7.44 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.01 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|