C31H60O7Si2 — CID 54578364
(3R,4S,6R,7R,11E,13S,14R)-4-[tert-butyl(dimethyl)silyl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,7,13-trimethyl-6-triethylsilyloxy-1-oxacyclotetradec-11-ene-2,10-dione (PubChem CID 54578364) has the molecular formula C31H60O7Si2 and a molecular weight of 600.99 g/mol. Its IUPAC name is (3R,4S,6R,7R,11E,13S,14R)-4-[tert-butyl(dimethyl)silyl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,7,13-trimethyl-6-triethylsilyloxy-1-oxacyclotetradec-11-ene-2,10-dione.
| Compound Name | (3R,4S,6R,7R,11E,13S,14R)-4-[tert-butyl(dimethyl)silyl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,7,13-trimethyl-6-triethylsilyloxy-1-oxacyclotetradec-11-ene-2,10-dione |
|---|---|
| PubChem CID | 54578364 |
| Molecular Formula | C31H60O7Si2 |
| Molecular Weight | 600.99 g/mol |
| Exact Mass | 600.39 |
| IUPAC Name | (3R,4S,6R,7R,11E,13S,14R)-4-[tert-butyl(dimethyl)silyl]oxy-14-ethyl-13-hydroxy-7-methoxy-3,7,13-trimethyl-6-triethylsilyloxy-1-oxacyclotetradec-11-ene-2,10-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](O[Si](CC)(CC)CC)[C@](C)(OC)CCC(=O)/C=C/[C@]1(C)O |
| InChI | InChI=1S/C31H60O7Si2/c1-14-26-30(9,34)20-18-24(32)19-21-31(10,35-11)27(38-40(15-2,16-3)17-4)22-25(23(5)28(33)36-26)37-39(12,13)29(6,7)8/h18,20,23,25-27,34H,14-17,19,21-22H2,1-13H3/b20-18+/t23-,25+,26-,27-,30+,31-/m1/s1 |
| InChIKey | ZSBFFVVFJJAYAX-VIHPCYKMSA-N |
| XLogP | 7.19 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.99 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|