C38H80O7Si3 — CID 135027414
[(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoate (PubChem CID 135027414) has the molecular formula C38H80O7Si3 and a molecular weight of 733.31 g/mol. Its IUPAC name is [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoate.
| Compound Name | [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoate |
|---|---|
| PubChem CID | 135027414 |
| Molecular Formula | C38H80O7Si3 |
| Molecular Weight | 733.31 g/mol |
| Exact Mass | 732.52 |
| IUPAC Name | [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoate |
| SMILES | C=C[C@](C)(O)[C@@H](CC)OC(=O)[C@H](C)[C@H](C[C@@H](O[Si](CC)(CC)CC)[C@@](C)(C[C@@H](C)CO[Si](C)(C)C(C)(C)C)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H80O7Si3/c1-21-32(37(14,40)22-2)43-34(39)30(7)31(44-47(19,20)36(11,12)13)26-33(45-48(23-3,24-4)25-5)38(15,41-16)27-29(6)28-42-46(17,18)35(8,9)10/h22,29-33,40H,2,21,23-28H2,1,3-20H3/t29-,30-,31+,32-,33-,37+,38-/m1/s1 |
| InChIKey | AEXRSMZBBZAMPR-FTYKSMDDSA-N |
| XLogP | 10.51 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.31 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|