C31H61IO7Si2 — CID 54577713
[(E,3R,4S)-4-hydroxy-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethyl-9-oxononanoate (PubChem CID 54577713) has the molecular formula C31H61IO7Si2 and a molecular weight of 728.90 g/mol. Its IUPAC name is [(E,3R,4S)-4-hydroxy-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethyl-9-oxononanoate.
| Compound Name | [(E,3R,4S)-4-hydroxy-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethyl-9-oxononanoate |
|---|---|
| PubChem CID | 54577713 |
| Molecular Formula | C31H61IO7Si2 |
| Molecular Weight | 728.90 g/mol |
| Exact Mass | 728.30 |
| IUPAC Name | [(E,3R,4S)-4-hydroxy-6-iodo-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethyl-9-oxononanoate |
| SMILES | CC[C@@H](OC(=O)[C@H](C)[C@H](C[C@@H](OC)[C@@](C)(CCC=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@](C)(O)/C=C/I |
| InChI | InChI=1S/C31H61IO7Si2/c1-16-25(30(9,35)19-20-32)37-27(34)23(2)24(38-40(12,13)28(3,4)5)22-26(36-11)31(10,18-17-21-33)39-41(14,15)29(6,7)8/h19-21,23-26,35H,16-18,22H2,1-15H3/b20-19+/t23-,24+,25-,26-,30+,31-/m1/s1 |
| InChIKey | CJSZCFPNTSSLQX-YNMWXLFPSA-N |
| XLogP | 8.20 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.90 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|