C32H63IO7Si2 — CID 135043681
[(E,3R,4S)-4-hydroxy-6-iodo-4-methylhept-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6-dimethyl-9-oxo-5-triethylsilyloxynonanoate (PubChem CID 135043681) has the molecular formula C32H63IO7Si2 and a molecular weight of 742.92 g/mol. Its IUPAC name is [(E,3R,4S)-4-hydroxy-6-iodo-4-methylhept-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6-dimethyl-9-oxo-5-triethylsilyloxynonanoate.
| Compound Name | [(E,3R,4S)-4-hydroxy-6-iodo-4-methylhept-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6-dimethyl-9-oxo-5-triethylsilyloxynonanoate |
|---|---|
| PubChem CID | 135043681 |
| Molecular Formula | C32H63IO7Si2 |
| Molecular Weight | 742.92 g/mol |
| Exact Mass | 742.32 |
| IUPAC Name | [(E,3R,4S)-4-hydroxy-6-iodo-4-methylhept-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6-dimethyl-9-oxo-5-triethylsilyloxynonanoate |
| SMILES | CC[C@@H](OC(=O)[C@H](C)[C@H](C[C@@H](O[Si](CC)(CC)CC)[C@@](C)(CCC=O)OC)O[Si](C)(C)C(C)(C)C)[C@@](C)(O)/C=C(\C)I |
| InChI | InChI=1S/C32H63IO7Si2/c1-15-27(31(10,36)23-24(5)33)38-29(35)25(6)26(39-41(13,14)30(7,8)9)22-28(32(11,37-12)20-19-21-34)40-42(16-2,17-3)18-4/h21,23,25-28,36H,15-20,22H2,1-14H3/b24-23+/t25-,26+,27-,28-,31+,32-/m1/s1 |
| InChIKey | SPKBNICLVYKVKH-JKHUGMIOSA-N |
| XLogP | 8.59 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.92 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|