C33H64O7Si2 — CID 54578588
[(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6-dimethyl-9-oxo-5-triethylsilyloxyundec-10-enoate (PubChem CID 54578588) has the molecular formula C33H64O7Si2 and a molecular weight of 629.04 g/mol. Its IUPAC name is [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6-dimethyl-9-oxo-5-triethylsilyloxyundec-10-enoate.
| Compound Name | [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6-dimethyl-9-oxo-5-triethylsilyloxyundec-10-enoate |
|---|---|
| PubChem CID | 54578588 |
| Molecular Formula | C33H64O7Si2 |
| Molecular Weight | 629.04 g/mol |
| Exact Mass | 628.42 |
| IUPAC Name | [(3R,4S)-4-hydroxy-4-methylhex-5-en-3-yl] (2R,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,6-dimethyl-9-oxo-5-triethylsilyloxyundec-10-enoate |
| SMILES | C=CC(=O)CC[C@@](C)(OC)[C@@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O[C@H](CC)[C@@](C)(O)C=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H64O7Si2/c1-16-26(34)22-23-33(12,37-13)29(40-42(19-4,20-5)21-6)24-27(39-41(14,15)31(8,9)10)25(7)30(35)38-28(17-2)32(11,36)18-3/h16,18,25,27-29,36H,1,3,17,19-24H2,2,4-15H3/t25-,27+,28-,29-,32+,33-/m1/s1 |
| InChIKey | DJUCOXWXFWZGRO-PROLILGCSA-N |
| XLogP | 7.99 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.04 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|