C35H72O7Si3 — CID 134866213
(E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoic acid (PubChem CID 134866213) has the molecular formula C35H72O7Si3 and a molecular weight of 689.21 g/mol. Its IUPAC name is (E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoic acid.
| Compound Name | (E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoic acid |
|---|---|
| PubChem CID | 134866213 |
| Molecular Formula | C35H72O7Si3 |
| Molecular Weight | 689.21 g/mol |
| Exact Mass | 688.46 |
| IUPAC Name | (E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoic acid |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@@H](C)[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](C)C(C)=O |
| InChI | InChI=1S/C35H72O7Si3/c1-20-45(21-2,22-3)42-30(27(7)31(39-15)32(33(37)38)41-44(18,19)35(12,13)14)26(6)29(25(5)23-24(4)28(8)36)40-43(16,17)34(9,10)11/h23-24,26-27,29-32H,20-22H2,1-19H3,(H,37,38)/b25-23+/t24-,26+,27+,29-,30-,31-,32+/m0/s1 |
| InChIKey | KZNOMSTXPXOVQA-HJGSLQMFSA-N |
| XLogP | 9.70 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.21 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|