C39H70O6Si2 — CID 134916490
(3S,6S,7R,9R,12S)-6-but-3-enyl-12-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7,11,14,14-tetramethyl-9-tributylsilyloxy-5-oxatricyclo[8.3.1.03,7]tetradec-10-ene-2,4-dione (PubChem CID 134916490) has the molecular formula C39H70O6Si2 and a molecular weight of 691.15 g/mol. Its IUPAC name is (3S,6S,7R,9R,12S)-6-but-3-enyl-12-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7,11,14,14-tetramethyl-9-tributylsilyloxy-5-oxatricyclo[8.3.1.03,7]tetradec-10-ene-2,4-dione.
| Compound Name | (3S,6S,7R,9R,12S)-6-but-3-enyl-12-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7,11,14,14-tetramethyl-9-tributylsilyloxy-5-oxatricyclo[8.3.1.03,7]tetradec-10-ene-2,4-dione |
|---|---|
| PubChem CID | 134916490 |
| Molecular Formula | C39H70O6Si2 |
| Molecular Weight | 691.15 g/mol |
| Exact Mass | 690.47 |
| IUPAC Name | (3S,6S,7R,9R,12S)-6-but-3-enyl-12-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7,11,14,14-tetramethyl-9-tributylsilyloxy-5-oxatricyclo[8.3.1.03,7]tetradec-10-ene-2,4-dione |
| SMILES | C=CCC[C@@H]1OC(=O)[C@@]2(O)C(=O)C3C[C@H](O[Si](C)(C)C(C)(C)C)C(C)=C([C@H](O[Si](CCCC)(CCCC)CCCC)C[C@]12C)C3(C)C |
| InChI | InChI=1S/C39H70O6Si2/c1-14-18-22-32-38(11)27-31(45-47(23-19-15-2,24-20-16-3)25-21-17-4)33-28(5)30(44-46(12,13)36(6,7)8)26-29(37(33,9)10)34(40)39(38,42)35(41)43-32/h14,29-32,42H,1,15-27H2,2-13H3/t29?,30-,31+,32-,38+,39-/m0/s1 |
| InChIKey | NARJQNUPHYPNNR-NTDRBODJSA-N |
| XLogP | 10.07 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.15 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|