C34H52O6Si — CID 10507549
[(1S,2S,3S,8R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-4-methoxy-8,12,15,15-tetramethyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl] 1-methylcyclohexa-2,5-diene-1-carboxylate (PubChem CID 10507549) has the molecular formula C34H52O6Si and a molecular weight of 584.87 g/mol. Its IUPAC name is [(1S,2S,3S,8R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-4-methoxy-8,12,15,15-tetramethyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl] 1-methylcyclohexa-2,5-diene-1-carboxylate.
| Compound Name | [(1S,2S,3S,8R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-4-methoxy-8,12,15,15-tetramethyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl] 1-methylcyclohexa-2,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 10507549 |
| Molecular Formula | C34H52O6Si |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | [(1S,2S,3S,8R,13S)-13-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-4-methoxy-8,12,15,15-tetramethyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadeca-4,11-dienyl] 1-methylcyclohexa-2,5-diene-1-carboxylate |
| SMILES | COC1=CCC[C@@]2(C)C(=O)CC3=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@](O)([C@@H](OC(=O)C4(C)C=CCC=C4)[C@@H]12)C3(C)C |
| InChI | InChI=1S/C34H52O6Si/c1-22-23-20-26(35)33(8)19-15-16-24(38-9)27(33)28(39-29(36)32(7)17-13-12-14-18-32)34(37,31(23,5)6)21-25(22)40-41(10,11)30(2,3)4/h13-14,16-18,25,27-28,37H,12,15,19-21H2,1-11H3/t25-,27+,28-,33-,34+/m0/s1 |
| InChIKey | OYKNSSZDTBKWPC-JFAAUNPTSA-N |
| XLogP | 7.21 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|