C33H58O5Si2 — CID 11028337
(1R,3S,6S,7S,9R,12S)-6-but-3-enyl-12-[tert-butyl(dimethyl)silyl]oxy-7,11,14,14-tetramethyl-9-triethylsilyloxy-5-oxatricyclo[8.3.1.03,7]tetradec-10-ene-2,4-dione (PubChem CID 11028337) has the molecular formula C33H58O5Si2 and a molecular weight of 590.99 g/mol. Its IUPAC name is (1R,3S,6S,7S,9R,12S)-6-but-3-enyl-12-[tert-butyl(dimethyl)silyl]oxy-7,11,14,14-tetramethyl-9-triethylsilyloxy-5-oxatricyclo[8.3.1.03,7]tetradec-10-ene-2,4-dione.
| Compound Name | (1R,3S,6S,7S,9R,12S)-6-but-3-enyl-12-[tert-butyl(dimethyl)silyl]oxy-7,11,14,14-tetramethyl-9-triethylsilyloxy-5-oxatricyclo[8.3.1.03,7]tetradec-10-ene-2,4-dione |
|---|---|
| PubChem CID | 11028337 |
| Molecular Formula | C33H58O5Si2 |
| Molecular Weight | 590.99 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | (1R,3S,6S,7S,9R,12S)-6-but-3-enyl-12-[tert-butyl(dimethyl)silyl]oxy-7,11,14,14-tetramethyl-9-triethylsilyloxy-5-oxatricyclo[8.3.1.03,7]tetradec-10-ene-2,4-dione |
| SMILES | C=CCC[C@@H]1OC(=O)[C@@H]2C(=O)[C@@H]3C[C@H](O[Si](C)(C)C(C)(C)C)C(C)=C([C@H](O[Si](CC)(CC)CC)C[C@@]21C)C3(C)C |
| InChI | InChI=1S/C33H58O5Si2/c1-14-18-19-26-33(11)21-25(38-40(15-2,16-3)17-4)27-22(5)24(37-39(12,13)31(6,7)8)20-23(32(27,9)10)29(34)28(33)30(35)36-26/h14,23-26,28H,1,15-21H2,2-13H3/t23-,24-,25+,26-,28-,33+/m0/s1 |
| InChIKey | WMWCYMUSVDPUTG-DSWKRPTJSA-N |
| XLogP | 8.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.99 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|