C26H40O4Si — CID 11026648
(1R,2R,6S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-4,13(16)-diene-7,14-dione (PubChem CID 11026648) has the molecular formula C26H40O4Si and a molecular weight of 444.69 g/mol. Its IUPAC name is (1R,2R,6S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-4,13(16)-diene-7,14-dione.
| Compound Name | (1R,2R,6S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-4,13(16)-diene-7,14-dione |
|---|---|
| PubChem CID | 11026648 |
| Molecular Formula | C26H40O4Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (1R,2R,6S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-4,13(16)-diene-7,14-dione |
| SMILES | CC1=CC[C@H]2[C@H]3OC(=O)C4=C3[C@](C)(CC(=O)[C@@H]1C2(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)CC4 |
| InChI | InChI=1S/C26H40O4Si/c1-15-10-12-17-22-21-16(23(28)29-22)11-13-19(30-31(8,9)24(2,3)4)26(21,7)14-18(27)20(15)25(17,5)6/h10,17,19-20,22H,11-14H2,1-9H3/t17-,19-,20+,22+,26+/m0/s1 |
| InChIKey | NNUVVQXIWASTMZ-GIXZVOAJSA-N |
| XLogP | 5.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|