C30H38O12 — CID 162871608
(2,4,7,8-tetraacetyloxy-5,9,17,17-tetramethyl-14-oxo-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-5,12-dien-10-yl) acetate (PubChem CID 162871608) has the molecular formula C30H38O12 and a molecular weight of 590.62 g/mol. Its IUPAC name is (2,4,7,8-tetraacetyloxy-5,9,17,17-tetramethyl-14-oxo-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-5,12-dien-10-yl) acetate.
| Compound Name | (2,4,7,8-tetraacetyloxy-5,9,17,17-tetramethyl-14-oxo-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-5,12-dien-10-yl) acetate |
|---|---|
| PubChem CID | 162871608 |
| Molecular Formula | C30H38O12 |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | (2,4,7,8-tetraacetyloxy-5,9,17,17-tetramethyl-14-oxo-15-oxatetracyclo[7.6.1.12,6.013,16]heptadeca-5,12-dien-10-yl) acetate |
| SMILES | CC(=O)OC1CC2(OC(C)=O)C3OC(=O)C4=CCC(OC(C)=O)C(C)(C(OC(C)=O)C(OC(C)=O)C(=C1C)C2(C)C)C43 |
| InChI | InChI=1S/C30H38O12/c1-13-20(37-14(2)31)12-30(42-18(6)35)25-23-19(27(36)41-25)10-11-21(38-15(3)32)29(23,9)26(40-17(5)34)24(39-16(4)33)22(13)28(30,7)8/h10,20-21,23-26H,11-12H2,1-9H3 |
| InChIKey | PAULMPXEAHEJHY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|