C25H36O6Si — CID 10961550
[(1R,2R,6R,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3,14-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-dien-6-yl] acetate (PubChem CID 10961550) has the molecular formula C25H36O6Si and a molecular weight of 460.64 g/mol. Its IUPAC name is [(1R,2R,6R,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3,14-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-dien-6-yl] acetate.
| Compound Name | [(1R,2R,6R,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3,14-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-dien-6-yl] acetate |
|---|---|
| PubChem CID | 10961550 |
| Molecular Formula | C25H36O6Si |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | [(1R,2R,6R,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3,14-dioxo-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-dien-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C(C)C(=O)[C@@]2(C)[C@@H]1CC(O[Si](C)(C)C(C)(C)C)=C1C[C@@H]3OC(=O)C[C@@H]3[C@H]12 |
| InChI | InChI=1S/C25H36O6Si/c1-13-9-20(29-14(2)26)17-12-19(31-32(7,8)24(3,4)5)15-10-18-16(11-21(27)30-18)22(15)25(17,6)23(13)28/h9,16-18,20,22H,10-12H2,1-8H3/t16-,17+,18-,20+,22-,25-/m0/s1 |
| InChIKey | ROJRBPVODDYUQB-RICRHEEISA-N |
| XLogP | 4.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|