C24H34O5Si — CID 135048330
(2S,7R,12R,15R,16R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,15-trimethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,6,14-trione (PubChem CID 135048330) has the molecular formula C24H34O5Si and a molecular weight of 430.62 g/mol. Its IUPAC name is (2S,7R,12R,15R,16R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,15-trimethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,6,14-trione.
| Compound Name | (2S,7R,12R,15R,16R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,15-trimethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,6,14-trione |
|---|---|
| PubChem CID | 135048330 |
| Molecular Formula | C24H34O5Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2S,7R,12R,15R,16R)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,15-trimethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,6,14-trione |
| SMILES | CC1=CC(=O)[C@@H]2CC(O[Si](C)(C)C(C)(C)C)=C3C[C@H]4OC(=O)[C@H](C)[C@H]4C3[C@]2(C)C1=O |
| InChI | InChI=1S/C24H34O5Si/c1-12-9-16(25)15-11-17(29-30(7,8)23(3,4)5)14-10-18-19(13(2)22(27)28-18)20(14)24(15,6)21(12)26/h9,13,15,18-20H,10-11H2,1-8H3/t13-,15+,18-,19-,20?,24-/m1/s1 |
| InChIKey | ZIDQIXJIXITLFL-KMPAMNAUSA-N |
| XLogP | 4.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|