C23H34O5Si — CID 11069801
(1R,2R,6S,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,4-dimethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,14-dione (PubChem CID 11069801) has the molecular formula C23H34O5Si and a molecular weight of 418.61 g/mol. Its IUPAC name is (1R,2R,6S,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,4-dimethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,14-dione.
| Compound Name | (1R,2R,6S,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,4-dimethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,14-dione |
|---|---|
| PubChem CID | 11069801 |
| Molecular Formula | C23H34O5Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (1R,2R,6S,7S,12S,16R)-9-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,4-dimethyl-13-oxatetracyclo[8.6.0.02,7.012,16]hexadeca-4,9-diene-3,14-dione |
| SMILES | CC1=C[C@H](O)[C@H]2CC(O[Si](C)(C)C(C)(C)C)=C3C[C@@H]4OC(=O)C[C@@H]4[C@H]3[C@@]2(C)C1=O |
| InChI | InChI=1S/C23H34O5Si/c1-12-8-16(24)15-11-18(28-29(6,7)22(2,3)4)13-9-17-14(10-19(25)27-17)20(13)23(15,5)21(12)26/h8,14-17,20,24H,9-11H2,1-7H3/t14-,15+,16-,17-,20-,23-/m0/s1 |
| InChIKey | LPLQGGCUCHMOSW-SYADNEKNSA-N |
| XLogP | 4.13 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|