C23H36O4Si — CID 10971485
[(5aS,6R,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-8,9a-dimethyl-9-oxo-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl] acetate (PubChem CID 10971485) has the molecular formula C23H36O4Si and a molecular weight of 404.62 g/mol. Its IUPAC name is [(5aS,6R,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-8,9a-dimethyl-9-oxo-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl] acetate.
| Compound Name | [(5aS,6R,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-8,9a-dimethyl-9-oxo-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl] acetate |
|---|---|
| PubChem CID | 10971485 |
| Molecular Formula | C23H36O4Si |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | [(5aS,6R,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-8,9a-dimethyl-9-oxo-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C(C)C(=O)[C@]2(C)[C@@H]3CCCC3=C(O[Si](C)(C)C(C)(C)C)C[C@H]12 |
| InChI | InChI=1S/C23H36O4Si/c1-14-12-20(26-15(2)24)18-13-19(27-28(7,8)22(3,4)5)16-10-9-11-17(16)23(18,6)21(14)25/h12,17-18,20H,9-11,13H2,1-8H3/t17-,18-,20-,23-/m1/s1 |
| InChIKey | QNNYJQLCHUDIQT-IVKZONNUSA-N |
| XLogP | 5.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|