C26H40O4Si — CID 154720438
(3aS,7aR)-5-[(5R)-5-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]cyclohexene-1-carbonyl]-4,7a-dimethyl-3,3a,6,7-tetrahydro-2-benzofuran-1-one (PubChem CID 154720438) has the molecular formula C26H40O4Si and a molecular weight of 444.69 g/mol. Its IUPAC name is (3aS,7aR)-5-[(5R)-5-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]cyclohexene-1-carbonyl]-4,7a-dimethyl-3,3a,6,7-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3aS,7aR)-5-[(5R)-5-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]cyclohexene-1-carbonyl]-4,7a-dimethyl-3,3a,6,7-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 154720438 |
| Molecular Formula | C26H40O4Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (3aS,7aR)-5-[(5R)-5-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]cyclohexene-1-carbonyl]-4,7a-dimethyl-3,3a,6,7-tetrahydro-2-benzofuran-1-one |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)[C@@H]1CCC=C(C(=O)C2=C(C)[C@@H]3COC(=O)[C@]3(C)CC2)C1 |
| InChI | InChI=1S/C26H40O4Si/c1-17(15-30-31(7,8)25(3,4)5)19-10-9-11-20(14-19)23(27)21-12-13-26(6)22(18(21)2)16-29-24(26)28/h11,19,22H,1,9-10,12-16H2,2-8H3/t19-,22+,26-/m1/s1 |
| InChIKey | KBCVALBMZCGMDJ-BORKOYIJSA-N |
| XLogP | 6.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|