C26H40O4Si — CID 154720437
8-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-3a,10b-dimethyl-4,6a,7,8,9,10,10a,10c-octahydro-1H-indeno[1,2-e][2]benzofuran-3,6-dione (PubChem CID 154720437) has the molecular formula C26H40O4Si and a molecular weight of 444.69 g/mol. Its IUPAC name is 8-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-3a,10b-dimethyl-4,6a,7,8,9,10,10a,10c-octahydro-1H-indeno[1,2-e][2]benzofuran-3,6-dione.
| Compound Name | 8-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-3a,10b-dimethyl-4,6a,7,8,9,10,10a,10c-octahydro-1H-indeno[1,2-e][2]benzofuran-3,6-dione |
|---|---|
| PubChem CID | 154720437 |
| Molecular Formula | C26H40O4Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 8-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-3a,10b-dimethyl-4,6a,7,8,9,10,10a,10c-octahydro-1H-indeno[1,2-e][2]benzofuran-3,6-dione |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)C1CCC2C(C1)C(=O)C1=CCC3(C)C(=O)OCC3C12C |
| InChI | InChI=1S/C26H40O4Si/c1-16(14-30-31(7,8)24(2,3)4)17-9-10-19-18(13-17)22(27)20-11-12-25(5)21(26(19,20)6)15-29-23(25)28/h11,17-19,21H,1,9-10,12-15H2,2-8H3 |
| InChIKey | PDYGFFARKDQOAZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|