C20H34O4Si — CID 53468895
(1R,4R,8S,9S,13S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-12,12-dimethyl-2,11-dioxatetracyclo[6.4.1.01,9.04,13]tridecan-10-one (PubChem CID 53468895) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is (1R,4R,8S,9S,13S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-12,12-dimethyl-2,11-dioxatetracyclo[6.4.1.01,9.04,13]tridecan-10-one.
| Compound Name | (1R,4R,8S,9S,13S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-12,12-dimethyl-2,11-dioxatetracyclo[6.4.1.01,9.04,13]tridecan-10-one |
|---|---|
| PubChem CID | 53468895 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (1R,4R,8S,9S,13S)-9-[[tert-butyl(dimethyl)silyl]oxymethyl]-12,12-dimethyl-2,11-dioxatetracyclo[6.4.1.01,9.04,13]tridecan-10-one |
| SMILES | CC1(C)OC(=O)[C@]2(CO[Si](C)(C)C(C)(C)C)[C@H]3CCC[C@H]4CO[C@@]12[C@H]43 |
| InChI | InChI=1S/C20H34O4Si/c1-17(2,3)25(6,7)23-12-19-14-10-8-9-13-11-22-20(19,15(13)14)18(4,5)24-16(19)21/h13-15H,8-12H2,1-7H3/t13-,14-,15+,19-,20-/m0/s1 |
| InChIKey | HHZHNRAYPYREGB-ARBHJEQISA-N |
| XLogP | 4.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|