C22H34O6SSi — CID 53381246
methyl (1R,2S,4S)-1-(benzenesulfonyl)-2-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-4-hydroxycyclopentane-1-carboxylate (PubChem CID 53381246) has the molecular formula C22H34O6SSi and a molecular weight of 454.66 g/mol. Its IUPAC name is methyl (1R,2S,4S)-1-(benzenesulfonyl)-2-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-4-hydroxycyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,4S)-1-(benzenesulfonyl)-2-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-4-hydroxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 53381246 |
| Molecular Formula | C22H34O6SSi |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | methyl (1R,2S,4S)-1-(benzenesulfonyl)-2-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-en-2-yl]-4-hydroxycyclopentane-1-carboxylate |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H](O)C[C@@]1(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H34O6SSi/c1-16(15-28-30(6,7)21(2,3)4)19-13-17(23)14-22(19,20(24)27-5)29(25,26)18-11-9-8-10-12-18/h8-12,17,19,23H,1,13-15H2,2-7H3/t17-,19-,22+/m0/s1 |
| InChIKey | ZISZBKDTIOPGAY-LQBOVUBWSA-N |
| XLogP | 3.72 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|