C27H36N2O5SSi — CID 11145843
N-[(2S,3R)-2-(benzenesulfonyl)-2-but-3-enyl-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-3-yl]-2-phenoxyacetamide (PubChem CID 11145843) has the molecular formula C27H36N2O5SSi and a molecular weight of 528.75 g/mol. Its IUPAC name is N-[(2S,3R)-2-(benzenesulfonyl)-2-but-3-enyl-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-3-yl]-2-phenoxyacetamide.
| Compound Name | N-[(2S,3R)-2-(benzenesulfonyl)-2-but-3-enyl-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-3-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 11145843 |
| Molecular Formula | C27H36N2O5SSi |
| Molecular Weight | 528.75 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | N-[(2S,3R)-2-(benzenesulfonyl)-2-but-3-enyl-1-[tert-butyl(dimethyl)silyl]-4-oxoazetidin-3-yl]-2-phenoxyacetamide |
| SMILES | C=CCC[C@]1(S(=O)(=O)c2ccccc2)[C@H](NC(=O)COc2ccccc2)C(=O)N1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H36N2O5SSi/c1-7-8-19-27(35(32,33)22-17-13-10-14-18-22)24(25(31)29(27)36(5,6)26(2,3)4)28-23(30)20-34-21-15-11-9-12-16-21/h7,9-18,24H,1,8,19-20H2,2-6H3,(H,28,30)/t24-,27+/m1/s1 |
| InChIKey | DBBNOPMRBHVBDV-SQHAQQRYSA-N |
| XLogP | 4.53 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.75 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|