C19H27NO5S — CID 10619850
tert-butyl (2R,3S)-3-(benzenesulfonyl)-2-(hydroxymethyl)-3-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 10619850) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-(benzenesulfonyl)-2-(hydroxymethyl)-3-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-(benzenesulfonyl)-2-(hydroxymethyl)-3-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10619850 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | tert-butyl (2R,3S)-3-(benzenesulfonyl)-2-(hydroxymethyl)-3-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@]1(S(=O)(=O)c2ccccc2)CCN(C(=O)OC(C)(C)C)[C@@H]1CO |
| InChI | InChI=1S/C19H27NO5S/c1-5-11-19(26(23,24)15-9-7-6-8-10-15)12-13-20(16(19)14-21)17(22)25-18(2,3)4/h5-10,16,21H,1,11-14H2,2-4H3/t16-,19+/m1/s1 |
| InChIKey | PDFPFXVIKXTIJM-APWZRJJASA-N |
| XLogP | 2.78 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|