C22H36O4SSi — CID 102092728
(1R)-1-[(1R,2R)-2-(benzenesulfonyl)-2-ethenylcyclopropyl]-5-[tert-butyl(dimethyl)silyl]oxypentan-1-ol (PubChem CID 102092728) has the molecular formula C22H36O4SSi and a molecular weight of 424.68 g/mol. Its IUPAC name is (1R)-1-[(1R,2R)-2-(benzenesulfonyl)-2-ethenylcyclopropyl]-5-[tert-butyl(dimethyl)silyl]oxypentan-1-ol.
| Compound Name | (1R)-1-[(1R,2R)-2-(benzenesulfonyl)-2-ethenylcyclopropyl]-5-[tert-butyl(dimethyl)silyl]oxypentan-1-ol |
|---|---|
| PubChem CID | 102092728 |
| Molecular Formula | C22H36O4SSi |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (1R)-1-[(1R,2R)-2-(benzenesulfonyl)-2-ethenylcyclopropyl]-5-[tert-butyl(dimethyl)silyl]oxypentan-1-ol |
| SMILES | C=C[C@]1(S(=O)(=O)c2ccccc2)C[C@@H]1[C@H](O)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36O4SSi/c1-7-22(27(24,25)18-13-9-8-10-14-18)17-19(22)20(23)15-11-12-16-26-28(5,6)21(2,3)4/h7-10,13-14,19-20,23H,1,11-12,15-17H2,2-6H3/t19-,20-,22+/m1/s1 |
| InChIKey | IIDOPFBKTJAFAJ-SJBKTWHCSA-N |
| XLogP | 4.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|