C24H37NO6SSi — CID 24749446
(6R,7R,7aS)-6-acetyl-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 24749446) has the molecular formula C24H37NO6SSi and a molecular weight of 495.71 g/mol. Its IUPAC name is (6R,7R,7aS)-6-acetyl-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6R,7R,7aS)-6-acetyl-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 24749446 |
| Molecular Formula | C24H37NO6SSi |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | (6R,7R,7aS)-6-acetyl-6-(benzenesulfonyl)-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,3-dimethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC(=O)[C@@]1(S(=O)(=O)c2ccccc2)C(=O)N2[C@H](COC2(C)C)[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H37NO6SSi/c1-17(26)24(32(28,29)18-12-10-9-11-13-18)19(14-15-31-33(7,8)22(2,3)4)20-16-30-23(5,6)25(20)21(24)27/h9-13,19-20H,14-16H2,1-8H3/t19-,20-,24+/m1/s1 |
| InChIKey | SXUNGVYLKAIEPS-REHUZNOOSA-N |
| XLogP | 3.79 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|