C23H31NO4SSi — CID 10837070
2-(benzenesulfonyl)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 10837070) has the molecular formula C23H31NO4SSi and a molecular weight of 445.66 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 2-(benzenesulfonyl)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 10837070 |
| Molecular Formula | C23H31NO4SSi |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(C)(C)[Si](C)(C)OCC1Cc2ccccc2N1C(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H31NO4SSi/c1-23(2,3)30(4,5)28-16-19-15-18-11-9-10-14-21(18)24(19)22(25)17-29(26,27)20-12-7-6-8-13-20/h6-14,19H,15-17H2,1-5H3 |
| InChIKey | YTDYOFGRHJCSPN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|