C22H33NO2Si — CID 10937576
1-[(1R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-prop-2-enyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one (PubChem CID 10937576) has the molecular formula C22H33NO2Si and a molecular weight of 371.60 g/mol. Its IUPAC name is 1-[(1R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-prop-2-enyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-prop-2-enyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10937576 |
| Molecular Formula | C22H33NO2Si |
| Molecular Weight | 371.60 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 1-[(1R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-prop-2-enyl-3,4-dihydro-1H-isoquinolin-2-yl]prop-2-en-1-one |
| SMILES | C=CC[C@@H]1c2ccccc2C[C@@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)C=C |
| InChI | InChI=1S/C22H33NO2Si/c1-8-12-20-19-14-11-10-13-17(19)15-18(23(20)21(24)9-2)16-25-26(6,7)22(3,4)5/h8-11,13-14,18,20H,1-2,12,15-16H2,3-7H3/t18-,20+/m0/s1 |
| InChIKey | HVDRMWACVNQMTJ-AZUAARDMSA-N |
| XLogP | 5.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|