C22H36O6SSi — CID 122224046
[(2S,3S,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxy-2-prop-2-enyloxolan-3-yl]methanesulfonic acid (PubChem CID 122224046) has the molecular formula C22H36O6SSi and a molecular weight of 456.68 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxy-2-prop-2-enyloxolan-3-yl]methanesulfonic acid.
| Compound Name | [(2S,3S,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxy-2-prop-2-enyloxolan-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 122224046 |
| Molecular Formula | C22H36O6SSi |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | [(2S,3S,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxy-2-prop-2-enyloxolan-3-yl]methanesulfonic acid |
| SMILES | C=CC[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OCc2ccccc2)[C@H]1CS(=O)(=O)O |
| InChI | InChI=1S/C22H36O6SSi/c1-7-11-19-18(16-29(23,24)25)21(26-14-17-12-9-8-10-13-17)20(28-19)15-27-30(5,6)22(2,3)4/h7-10,12-13,18-21H,1,11,14-16H2,2-6H3,(H,23,24,25)/t18-,19-,20+,21-/m0/s1 |
| InChIKey | WNLFCHQLYWSGEN-BURNTYAHSA-N |
| XLogP | 4.44 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|