C20H31N3O5SSi — CID 101194770
2-(benzenesulfonyl)-1-[(4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-oxazolidin-3-yl]-2-diazoethanone (PubChem CID 101194770) has the molecular formula C20H31N3O5SSi and a molecular weight of 453.64 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[(4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-oxazolidin-3-yl]-2-diazoethanone.
| Compound Name | 2-(benzenesulfonyl)-1-[(4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-oxazolidin-3-yl]-2-diazoethanone |
|---|---|
| PubChem CID | 101194770 |
| Molecular Formula | C20H31N3O5SSi |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[(4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-oxazolidin-3-yl]-2-diazoethanone |
| SMILES | CC1(C)OC[C@@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)C(=[N+]=[N-])S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H31N3O5SSi/c1-19(2,3)30(6,7)28-14-15-13-27-20(4,5)23(15)18(24)17(22-21)29(25,26)16-11-9-8-10-12-16/h8-12,15H,13-14H2,1-7H3/t15-/m0/s1 |
| InChIKey | CSEKLWMZBBPSLW-HNNXBMFYSA-N |
| XLogP | 3.07 |
| TPSA | 109.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|