C23H40N2O5SSi2 — CID 135406577
(4S)-1-(benzenesulfonyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-diazopentan-2-one (PubChem CID 135406577) has the molecular formula C23H40N2O5SSi2 and a molecular weight of 512.82 g/mol. Its IUPAC name is (4S)-1-(benzenesulfonyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-diazopentan-2-one.
| Compound Name | (4S)-1-(benzenesulfonyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-diazopentan-2-one |
|---|---|
| PubChem CID | 135406577 |
| Molecular Formula | C23H40N2O5SSi2 |
| Molecular Weight | 512.82 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | (4S)-1-(benzenesulfonyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-diazopentan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](CC(=O)C(=[N+]=[N-])S(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40N2O5SSi2/c1-22(2,3)32(7,8)29-17-18(30-33(9,10)23(4,5)6)16-20(26)21(25-24)31(27,28)19-14-12-11-13-15-19/h11-15,18H,16-17H2,1-10H3/t18-/m0/s1 |
| InChIKey | YXKKUMVPFFQREY-SFHVURJKSA-N |
| XLogP | 5.46 |
| TPSA | 106.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.82 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|