C20H30N2O3Si — CID 102252798
N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-2,3-dihydropyridin-1-yl]benzamide (PubChem CID 102252798) has the molecular formula C20H30N2O3Si and a molecular weight of 374.56 g/mol. Its IUPAC name is N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-2,3-dihydropyridin-1-yl]benzamide.
| Compound Name | N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-2,3-dihydropyridin-1-yl]benzamide |
|---|---|
| PubChem CID | 102252798 |
| Molecular Formula | C20H30N2O3Si |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxo-2,3-dihydropyridin-1-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1CC(=O)C=CN1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H30N2O3Si/c1-20(2,3)26(4,5)25-14-12-17-15-18(23)11-13-22(17)21-19(24)16-9-7-6-8-10-16/h6-11,13,17H,12,14-15H2,1-5H3,(H,21,24) |
| InChIKey | DYSZLMATJOQNLP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|