C19H33N3O2Si — CID 176705835
3-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrrolidin-1-yl]benzohydrazide (PubChem CID 176705835) has the molecular formula C19H33N3O2Si and a molecular weight of 363.58 g/mol. Its IUPAC name is 3-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrrolidin-1-yl]benzohydrazide.
| Compound Name | 3-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrrolidin-1-yl]benzohydrazide |
|---|---|
| PubChem CID | 176705835 |
| Molecular Formula | C19H33N3O2Si |
| Molecular Weight | 363.58 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 3-[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyrrolidin-1-yl]benzohydrazide |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1CCN(c2cccc(C(=O)NN)c2)C1 |
| InChI | InChI=1S/C19H33N3O2Si/c1-19(2,3)25(4,5)24-12-10-15-9-11-22(14-15)17-8-6-7-16(13-17)18(23)21-20/h6-8,13,15H,9-12,14,20H2,1-5H3,(H,21,23) |
| InChIKey | JCBVDARNZDFGAP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|