C22H36N4O2Si — CID 176705819
3-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidin-1-yl]phenyl]-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 176705819) has the molecular formula C22H36N4O2Si and a molecular weight of 416.64 g/mol. Its IUPAC name is 3-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidin-1-yl]phenyl]-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidin-1-yl]phenyl]-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 176705819 |
| Molecular Formula | C22H36N4O2Si |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 3-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperidin-1-yl]phenyl]-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | Cn1c(-c2cccc(N3CCC(CCO[Si](C)(C)C(C)(C)C)CC3)c2)n[nH]c1=O |
| InChI | InChI=1S/C22H36N4O2Si/c1-22(2,3)29(5,6)28-15-12-17-10-13-26(14-11-17)19-9-7-8-18(16-19)20-23-24-21(27)25(20)4/h7-9,16-17H,10-15H2,1-6H3,(H,24,27) |
| InChIKey | YNAPQIBLBQZOLN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|