C29H37N5OSi — CID 169092397
tert-butyl-dimethyl-[[3-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]phenyl]methoxy]silane (PubChem CID 169092397) has the molecular formula C29H37N5OSi and a molecular weight of 499.74 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[3-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]phenyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[3-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]phenyl]methoxy]silane |
|---|---|
| PubChem CID | 169092397 |
| Molecular Formula | C29H37N5OSi |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | tert-butyl-dimethyl-[[3-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]phenyl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(N2CCC(n3cc(-c4cnc5ccccc5n4)cn3)CC2)c1 |
| InChI | InChI=1S/C29H37N5OSi/c1-29(2,3)36(4,5)35-21-22-9-8-10-25(17-22)33-15-13-24(14-16-33)34-20-23(18-31-34)28-19-30-26-11-6-7-12-27(26)32-28/h6-12,17-20,24H,13-16,21H2,1-5H3 |
| InChIKey | HWUFMFLUTRJOJN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|