C18H19N5O2 — CID 175468049
[3-(4-quinoxalin-2-ylpyrazol-1-yl)cyclohexyl] carbamate (PubChem CID 175468049) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is [3-(4-quinoxalin-2-ylpyrazol-1-yl)cyclohexyl] carbamate.
| Compound Name | [3-(4-quinoxalin-2-ylpyrazol-1-yl)cyclohexyl] carbamate |
|---|---|
| PubChem CID | 175468049 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [3-(4-quinoxalin-2-ylpyrazol-1-yl)cyclohexyl] carbamate |
| SMILES | NC(=O)OC1CCCC(n2cc(-c3cnc4ccccc4n3)cn2)C1 |
| InChI | InChI=1S/C18H19N5O2/c19-18(24)25-14-5-3-4-13(8-14)23-11-12(9-21-23)17-10-20-15-6-1-2-7-16(15)22-17/h1-2,6-7,9-11,13-14H,3-5,8H2,(H2,19,24) |
| InChIKey | RSWZRABJVIZCLQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |