C22H26N6O — CID 170778313
[3-(aminomethyl)cyclobutyl]-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]methanone (PubChem CID 170778313) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is [3-(aminomethyl)cyclobutyl]-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]methanone.
| Compound Name | [3-(aminomethyl)cyclobutyl]-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 170778313 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [3-(aminomethyl)cyclobutyl]-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]methanone |
| SMILES | NCC1CC(C(=O)N2CCC(n3cc(-c4cnc5ccccc5n4)cn3)CC2)C1 |
| InChI | InChI=1S/C22H26N6O/c23-11-15-9-16(10-15)22(29)27-7-5-18(6-8-27)28-14-17(12-25-28)21-13-24-19-3-1-2-4-20(19)26-21/h1-4,12-16,18H,5-11,23H2 |
| InChIKey | JMPRFRKKTYOBLH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |