C34H36N8O5 — CID 166995042
2-(2-hydroxy-6-oxopiperidin-3-yl)-5-[[5-oxo-5-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]pentyl]amino]isoindole-1,3-dione (PubChem CID 166995042) has the molecular formula C34H36N8O5 and a molecular weight of 636.71 g/mol. Its IUPAC name is 2-(2-hydroxy-6-oxopiperidin-3-yl)-5-[[5-oxo-5-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]pentyl]amino]isoindole-1,3-dione.
| Compound Name | 2-(2-hydroxy-6-oxopiperidin-3-yl)-5-[[5-oxo-5-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]pentyl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166995042 |
| Molecular Formula | C34H36N8O5 |
| Molecular Weight | 636.71 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | 2-(2-hydroxy-6-oxopiperidin-3-yl)-5-[[5-oxo-5-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]pentyl]amino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCC(=O)N4CCC(n5cc(-c6cnc7ccccc7n6)cn5)CC4)cc3C2=O)C(O)N1 |
| InChI | InChI=1S/C34H36N8O5/c43-30-11-10-29(32(45)39-30)42-33(46)24-9-8-22(17-25(24)34(42)47)35-14-4-3-7-31(44)40-15-12-23(13-16-40)41-20-21(18-37-41)28-19-36-26-5-1-2-6-27(26)38-28/h1-2,5-6,8-9,17-20,23,29,32,35,45H,3-4,7,10-16H2,(H,39,43) |
| InChIKey | XKQYYKLMFIPVPR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.71 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|