C33H31N7O4 — CID 170548286
2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-(4-quinoxalin-2-ylpyrazol-1-yl)spiro[3.3]heptan-6-yl]ethylamino]isoindole-1,3-dione (PubChem CID 170548286) has the molecular formula C33H31N7O4 and a molecular weight of 589.66 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-(4-quinoxalin-2-ylpyrazol-1-yl)spiro[3.3]heptan-6-yl]ethylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-(4-quinoxalin-2-ylpyrazol-1-yl)spiro[3.3]heptan-6-yl]ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170548286 |
| Molecular Formula | C33H31N7O4 |
| Molecular Weight | 589.66 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-(4-quinoxalin-2-ylpyrazol-1-yl)spiro[3.3]heptan-6-yl]ethylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCC4CC5(C4)CC(n4cc(-c6cnc7ccccc7n6)cn4)C5)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H31N7O4/c41-29-8-7-28(30(42)38-29)40-31(43)23-6-5-21(11-24(23)32(40)44)34-10-9-19-12-33(13-19)14-22(15-33)39-18-20(16-36-39)27-17-35-25-3-1-2-4-26(25)37-27/h1-6,11,16-19,22,28,34H,7-10,12-15H2,(H,38,41,42) |
| InChIKey | HTEXHAYAXYEKCW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|