C33H33N7O4 — CID 166994041
5-[6-(3-cyclopropyl-4-quinoxalin-2-ylpyrazol-1-yl)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 166994041) has the molecular formula C33H33N7O4 and a molecular weight of 591.67 g/mol. Its IUPAC name is 5-[6-(3-cyclopropyl-4-quinoxalin-2-ylpyrazol-1-yl)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[6-(3-cyclopropyl-4-quinoxalin-2-ylpyrazol-1-yl)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166994041 |
| Molecular Formula | C33H33N7O4 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 5-[6-(3-cyclopropyl-4-quinoxalin-2-ylpyrazol-1-yl)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCCCn4cc(-c5cnc6ccccc6n5)c(C5CC5)n4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H33N7O4/c41-29-14-13-28(31(42)37-29)40-32(43)22-12-11-21(17-23(22)33(40)44)34-15-5-1-2-6-16-39-19-24(30(38-39)20-9-10-20)27-18-35-25-7-3-4-8-26(25)36-27/h3-4,7-8,11-12,17-20,28,34H,1-2,5-6,9-10,13-16H2,(H,37,41,42) |
| InChIKey | BDOIJQPNDMMRJW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|