C31H31N7O5 — CID 170548278
2-(2,6-dioxopiperidin-3-yl)-5-[6-[4-(8-methoxyquinoxalin-2-yl)pyrazol-1-yl]hexylamino]isoindole-1,3-dione (PubChem CID 170548278) has the molecular formula C31H31N7O5 and a molecular weight of 581.63 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[6-[4-(8-methoxyquinoxalin-2-yl)pyrazol-1-yl]hexylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[6-[4-(8-methoxyquinoxalin-2-yl)pyrazol-1-yl]hexylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170548278 |
| Molecular Formula | C31H31N7O5 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[6-[4-(8-methoxyquinoxalin-2-yl)pyrazol-1-yl]hexylamino]isoindole-1,3-dione |
| SMILES | COc1cccc2ncc(-c3cnn(CCCCCCNc4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)c3)nc12 |
| InChI | InChI=1S/C31H31N7O5/c1-43-26-8-6-7-23-28(26)35-24(17-33-23)19-16-34-37(18-19)14-5-3-2-4-13-32-20-9-10-21-22(15-20)31(42)38(30(21)41)25-11-12-27(39)36-29(25)40/h6-10,15-18,25,32H,2-5,11-14H2,1H3,(H,36,39,40) |
| InChIKey | JPOJVPKQHUJWMI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|